| Alias: | (+/-)-2-Amino-3-hydroxypropionic acid; H-DL-Ser-OH | 
| CAS: | 302-84-1 | 
| EINECS: | 206-130-6 | 
| Molecular formula: | C3H7NO3 | 
| Molecular weight: | 105.0926 | 
| InChI: | InChI=1/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7)/t2-/m1/s1 | 
| Molecular structure: |  | 
| Density: | 1.415g/cm3 | 
| Melting point: | 240℃ (dec.) | 
| Boiling point: | 394.8°C at 760 mmHg | 
| Point: | 192.6°C | 
| Water solubility: | 50.23 g/L (25℃) | 
| Steam pressure: | 7.17E-08mmHg at 25°C | 
| Physicochemical properties: | Density 1.53 | 
| Melting point 240°C (dec.) | |
| Water solubility 50.23 g/L (25°C) | 








 Original
 Original
 
  [3Year(s)] Member index:4
 [3Year(s)] Member index:4 The company profile was verified by
 The company profile was verified by  	






