| Alias: | L-Cysteine hydrochloride; L-cysteine hcl cell culture tested; H-Cys-OH.HCl; L-Cysteine Hcl Anhydrous; L-Cysteine HCl; Di-isopropyl nahpthalene; L-cysteine hydrochloride (1:1); L-Cysteine HCl anhydrate; cysteine, chloride (1:1); 2-(2-Methoxy Ethoxy) Acetaldehyde Dimethyl Actal | 
| CAS: | 52-89-1 | 
| EINECS: | 200-157-7 | 
| Molecular formula: | C3H7ClNO2S | 
| Molecular weight: | 156.6117 | 
| InChI: | InChI=1/C3H7ClNO2S.ClH/c4-2(1-7)3(5)6;/h2,7H,1,4H2,(H,5,6);1H/p-1 | 
| Molecular structure: |  | 
| Boiling point: | 305.8°C at 760 mmHg | 
| Point: | 138.7°C | 
| Water solubility: | SOLUBLE | 
| Steam pressure: | 0.000183mmHg at 25°C | 








 Original
 Original
 
  [3Year(s)] Member index:4
 [3Year(s)] Member index:4 The company profile was verified by
 The company profile was verified by  	







