| Alias: | L-cysteine hcl monohydrate; H-Cys-OH.HCl.H2O; H-Cys-OH.HCl.H_2O; L-cysteine hydrochloride hydrate; L-Cystene Hydrochloride Monohydrate | 
| CAS: | 7048-04-6 | 
| EINECS: | 200-157-7 | 
| Molecular formula: | C3H10ClNO3S | 
| Molecular weight: | 175.6344 | 
| InChI: | InChI=1/C3H10ClNO3S.ClH.H2O/c4-2(1-7)3(5)6;;/h2,7H,1,4H2,(H,5,6);1H;1H2/t2-;;/m0../s1 | 
| Molecular structure: |  | 
| Boiling point: | 293.9°C at 760 mmHg | 
| Point: | 131.5°C | 
| Steam pressure: | 0.000411mmHg at 25°C | 








 Original
 Original
 
  [3Year(s)] Member index:4
 [3Year(s)] Member index:4 The company profile was verified by
 The company profile was verified by  	







