| Alias: | L(-)-3,3-Dithiobis(2-aminopropanoic acid); L-Cystine, synthetically derived; (H-Cys-OH)2 (Disulfide bond); (H-Cys-OH)2; H-(Cys)_2-OH; (-)-3,3-Dithiobis(2-aminopropionic acid); 2-Amino-3-[(2-amino-2-carboxyethyl)dithio]propanoic acid; L-Cystine,food grade; Cystine; (2R,2'S)-3,3'-disulfanediylbis(2-ammoniopropanoate); Dicysteine | 
| CAS: | 56-89-3;24645-67-8 | 
| EINECS: | 200-296-3 | 
| Molecular formula: | C3H7NO2S3 | 
| Molecular weight: | 185.28818 | 
| InChI: | InChI=1/C3H7NO2S3/c5-3(6)2(4-7)1-9-8/h2H,1,4H2,(H,5,6) | 
| Molecular structure: |  | 
| Melting point: | 260-261℃ | 
| Water solubility: | 0.112 g/L (25℃) | 








 Original
 Original
 
  [3Year(s)] Member index:4
 [3Year(s)] Member index:4 The company profile was verified by
 The company profile was verified by  	







