max at gmail dot com
Synonyms: (Z)-15-Tetracosaenoic Acid; Selacholeic acid; cis-15-Tetracosenoic acid;
Source: From Malania oleifera fruits
Formula: CH3(CH2)7CH=CH(CH2)13COOH (cis)
Molecular: 366.62
CAS Registry Number: 506-37-6
De
Content: 90%min
Packing: 0.5kg, 1kg or customized
Fuction and Application:
1. Increase protein of brain
2. Improve memory
3. Anti-aging
4. Decrease the blood fat.
5. Can be used for formula milk powder and health care capsule




